C29H35NO2 — CID 133201667
N-[4-(1-adamantyl)phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide (PubChem CID 133201667) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
|---|---|
| PubChem CID | 133201667 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
| SMILES | CC(Oc1ccc2c(c1)CCCC2)C(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H35NO2/c1-19(32-27-11-6-23-4-2-3-5-24(23)15-27)28(31)30-26-9-7-25(8-10-26)29-16-20-12-21(17-29)14-22(13-20)18-29/h6-11,15,19-22H,2-5,12-14,16-18H2,1H3,(H,30,31) |
| InChIKey | FOEGBVYUWGYEOU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |