C30H33NO2 — CID 28580164
(2S)-N-[4-(1-adamantyl)phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 28580164) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is (2S)-N-[4-(1-adamantyl)phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[4-(1-adamantyl)phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 28580164 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (2S)-N-[4-(1-adamantyl)phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C30H33NO2/c1-2-28(33-27-12-7-23-5-3-4-6-24(23)16-27)29(32)31-26-10-8-25(9-11-26)30-17-20-13-21(18-30)15-22(14-20)19-30/h3-12,16,20-22,28H,2,13-15,17-19H2,1H3,(H,31,32)/t20?,21?,22?,28-,30?/m0/s1 |
| InChIKey | UTQQZCYXDFPTKL-LCXHTYQMSA-N |
| XLogP | 7.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |