C22H32 — CID 18177948
1,1,4,4-tetramethyl-6-oct-1-yn-3-yl-2,3-dihydronaphthalene (PubChem CID 18177948) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-oct-1-yn-3-yl-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-oct-1-yn-3-yl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 18177948 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-oct-1-yn-3-yl-2,3-dihydronaphthalene |
| SMILES | C#CC(CCCCC)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H32/c1-7-9-10-11-17(8-2)18-12-13-19-20(16-18)22(5,6)15-14-21(19,3)4/h2,12-13,16-17H,7,9-11,14-15H2,1,3-6H3 |
| InChIKey | XFJVQLCKTILVGW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|