C28H40O3 — CID 10320172
ethyl (2E,4E)-5-[(1S,2S)-2-(7-hexyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 10320172) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(1S,2S)-2-(7-hexyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(1S,2S)-2-(7-hexyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 10320172 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | ethyl (2E,4E)-5-[(1S,2S)-2-(7-hexyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCCCCCc1cc([C@@]2(C)C[C@H]2/C=C/C(C)=C/C(=O)OCC)cc2c1OCC2(C)C |
| InChI | InChI=1S/C28H40O3/c1-7-9-10-11-12-21-16-23(17-24-26(21)31-19-27(24,4)5)28(6)18-22(28)14-13-20(3)15-25(29)30-8-2/h13-17,22H,7-12,18-19H2,1-6H3/b14-13+,20-15+/t22-,28+/m1/s1 |
| InChIKey | QPDZJVHULGCFBY-YCPGYQEASA-N |
| XLogP | 6.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|