C27H36O3 — CID 10341422
(2E,4E)-5-[(1S,2S)-2-[7-(cyclohexylmethyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 10341422) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (2E,4E)-5-[(1S,2S)-2-[7-(cyclohexylmethyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1S,2S)-2-[7-(cyclohexylmethyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10341422 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (2E,4E)-5-[(1S,2S)-2-[7-(cyclohexylmethyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/[C@@H]1C[C@]1(C)c1cc(CC2CCCCC2)c2c(c1)C(C)(C)CO2)=C\C(=O)O |
| InChI | InChI=1S/C27H36O3/c1-18(12-24(28)29)10-11-21-16-27(21,4)22-14-20(13-19-8-6-5-7-9-19)25-23(15-22)26(2,3)17-30-25/h10-12,14-15,19,21H,5-9,13,16-17H2,1-4H3,(H,28,29)/b11-10+,18-12+/t21-,27+/m1/s1 |
| InChIKey | HDFGXLBPANXHLD-VKQVDORASA-N |
| XLogP | 6.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|