C33H42O3 — CID 90930803
5-[(1S)-2-[7-(2-heptylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 90930803) has the molecular formula C33H42O3 and a molecular weight of 486.70 g/mol. Its IUPAC name is 5-[(1S)-2-[7-(2-heptylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(1S)-2-[7-(2-heptylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90930803 |
| Molecular Formula | C33H42O3 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 5-[(1S)-2-[7-(2-heptylphenyl)-3,3-dimethyl-2H-1-benzofuran-5-yl]-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCCCCCc1ccccc1-c1cc(C2(C)C[C@H]2C=CC(C)=CC(=O)O)cc2c1OCC2(C)C |
| InChI | InChI=1S/C33H42O3/c1-6-7-8-9-10-13-24-14-11-12-15-27(24)28-19-26(20-29-31(28)36-22-32(29,3)4)33(5)21-25(33)17-16-23(2)18-30(34)35/h11-12,14-20,25H,6-10,13,21-22H2,1-5H3,(H,34,35)/t25-,33?/m1/s1 |
| InChIKey | VPIVRYDOZGGIEB-NHYGQJMQSA-N |
| XLogP | 8.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|