C23H30O3 — CID 91371261
5-[(1S,2S)-2-(3,3-dimethyl-7-propan-2-yl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 91371261) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 5-[(1S,2S)-2-(3,3-dimethyl-7-propan-2-yl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(1S,2S)-2-(3,3-dimethyl-7-propan-2-yl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91371261 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5-[(1S,2S)-2-(3,3-dimethyl-7-propan-2-yl-2H-1-benzofuran-5-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=C[C@@H]1C[C@]1(C)c1cc(C(C)C)c2c(c1)C(C)(C)CO2)=CC(=O)O |
| InChI | InChI=1S/C23H30O3/c1-14(2)18-10-17(11-19-21(18)26-13-22(19,4)5)23(6)12-16(23)8-7-15(3)9-20(24)25/h7-11,14,16H,12-13H2,1-6H3,(H,24,25)/t16-,23+/m1/s1 |
| InChIKey | YDUOMMOHRNAYTO-MWTRTKDXSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|