C26H35NO3 — CID 57034409
ethyl 5-[(1S,2S)-2-(4,4-dimethyl-2-oxo-1-propan-2-yl-3H-quinolin-6-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 57034409) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is ethyl 5-[(1S,2S)-2-(4,4-dimethyl-2-oxo-1-propan-2-yl-3H-quinolin-6-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[(1S,2S)-2-(4,4-dimethyl-2-oxo-1-propan-2-yl-3H-quinolin-6-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 57034409 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | ethyl 5-[(1S,2S)-2-(4,4-dimethyl-2-oxo-1-propan-2-yl-3H-quinolin-6-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=C[C@@H]1C[C@]1(C)c1ccc2c(c1)C(C)(C)CC(=O)N2C(C)C |
| InChI | InChI=1S/C26H35NO3/c1-8-30-24(29)13-18(4)9-10-20-15-26(20,7)19-11-12-22-21(14-19)25(5,6)16-23(28)27(22)17(2)3/h9-14,17,20H,8,15-16H2,1-7H3/t20-,26-/m1/s1 |
| InChIKey | OSGKLYHFDCZPDU-FQRUVTKNSA-N |
| XLogP | 5.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|