C23H30FNO2 — CID 22091388
methyl (2E,4E,6E)-6-fluoro-3-methyl-7-(4-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate (PubChem CID 22091388) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl (2E,4E,6E)-6-fluoro-3-methyl-7-(4-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate.
| Compound Name | methyl (2E,4E,6E)-6-fluoro-3-methyl-7-(4-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 22091388 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | methyl (2E,4E,6E)-6-fluoro-3-methyl-7-(4-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoate |
| SMILES | COC(=O)/C=C(C)/C=C/C(F)=C(/C)c1ccc2c(c1)C(C)CCN2C(C)C |
| InChI | InChI=1S/C23H30FNO2/c1-15(2)25-12-11-17(4)20-14-19(8-10-22(20)25)18(5)21(24)9-7-16(3)13-23(26)27-6/h7-10,13-15,17H,11-12H2,1-6H3/b9-7+,16-13+,21-18+ |
| InChIKey | WXOOHQGDWCTYGH-MSEIHFIZSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|