C19H26FNO2 — CID 54273299
ethyl 2-fluoro-3-(3-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate (PubChem CID 54273299) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is ethyl 2-fluoro-3-(3-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate.
| Compound Name | ethyl 2-fluoro-3-(3-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate |
|---|---|
| PubChem CID | 54273299 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | ethyl 2-fluoro-3-(3-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate |
| SMILES | CCOC(=O)C(F)=C(C)c1ccc2c(c1)CC(C)CN2C(C)C |
| InChI | InChI=1S/C19H26FNO2/c1-6-23-19(22)18(20)14(5)15-7-8-17-16(10-15)9-13(4)11-21(17)12(2)3/h7-8,10,12-13H,6,9,11H2,1-5H3 |
| InChIKey | RLRIRXWUDJRSDT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|