C18H22FNO4 — CID 54466377
diethyl 2-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedioate (PubChem CID 54466377) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is diethyl 2-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 54466377 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | diethyl 2-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1c2ccc(F)cc2CCC1C)C(=O)OCC |
| InChI | InChI=1S/C18H22FNO4/c1-4-23-17(21)15(18(22)24-5-2)11-20-12(3)6-7-13-10-14(19)8-9-16(13)20/h8-12H,4-7H2,1-3H3 |
| InChIKey | XFDLJNAGQPPZFJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|