C18H24FNO2 — CID 54108510
ethyl 2-fluoro-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate (PubChem CID 54108510) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is ethyl 2-fluoro-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate.
| Compound Name | ethyl 2-fluoro-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate |
|---|---|
| PubChem CID | 54108510 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | ethyl 2-fluoro-3-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)but-2-enoate |
| SMILES | CCOC(=O)C(F)=C(C)c1ccc2c(c1)CCCN2C(C)C |
| InChI | InChI=1S/C18H24FNO2/c1-5-22-18(21)17(19)13(4)14-8-9-16-15(11-14)7-6-10-20(16)12(2)3/h8-9,11-12H,5-7,10H2,1-4H3 |
| InChIKey | NFKUVENFXSYWCW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|