C24H31NO3 — CID 54126366
(2E,4E)-5-[(2S)-2-(1-acetyl-4,4,6-trimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 54126366) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2E,4E)-5-[(2S)-2-(1-acetyl-4,4,6-trimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(2S)-2-(1-acetyl-4,4,6-trimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54126366 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2E,4E)-5-[(2S)-2-(1-acetyl-4,4,6-trimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=O)N1CCC(C)(C)c2cc(C)c([C@@]3(C)CC3/C=C/C(C)=C/C(=O)O)cc21 |
| InChI | InChI=1S/C24H31NO3/c1-15(11-22(27)28)7-8-18-14-24(18,6)19-13-21-20(12-16(19)2)23(4,5)9-10-25(21)17(3)26/h7-8,11-13,18H,9-10,14H2,1-6H3,(H,27,28)/b8-7+,15-11+/t18?,24-/m0/s1 |
| InChIKey | NRFZDQRZGLGFDO-QBHDXUIJSA-N |
| XLogP | 4.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|