C18H22O2 — CID 21348175
(2E,4E)-5-[2-(3,5-dimethylphenyl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 21348175) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2E,4E)-5-[2-(3,5-dimethylphenyl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[2-(3,5-dimethylphenyl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 21348175 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2E,4E)-5-[2-(3,5-dimethylphenyl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1CC1(C)c1cc(C)cc(C)c1)=C\C(=O)O |
| InChI | InChI=1S/C18H22O2/c1-12(10-17(19)20)5-6-15-11-18(15,4)16-8-13(2)7-14(3)9-16/h5-10,15H,11H2,1-4H3,(H,19,20)/b6-5+,12-10+ |
| InChIKey | NPKXAQGZNXDFPF-VTNGQZISSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|