C15H24O4 — CID 102367642
(2E,4E)-5-[(3S,4R,6R)-3,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 102367642) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2E,4E)-5-[(3S,4R,6R)-3,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(3S,4R,6R)-3,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 102367642 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2E,4E)-5-[(3S,4R,6R)-3,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1[C@H](C)C[C@@H](O)[C@@H](O)C1(C)C)=C\C(=O)O |
| InChI | InChI=1S/C15H24O4/c1-9(7-13(17)18)5-6-11-10(2)8-12(16)14(19)15(11,3)4/h5-7,10-12,14,16,19H,8H2,1-4H3,(H,17,18)/b6-5+,9-7+/t10-,11?,12-,14-/m1/s1 |
| InChIKey | MSGLVYRESMKEPC-WENHMUGBSA-N |
| XLogP | 1.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|