C15H20O4 — CID 162853925
5-[(1S,5S,8R)-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 162853925) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-[(1S,5S,8R)-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(1S,5S,8R)-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 162853925 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-[(1S,5S,8R)-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=C[C@@H]1[C@@]2(C)CO[C@@]1(C)CC(=O)C2)=CC(=O)O |
| InChI | InChI=1S/C15H20O4/c1-10(6-13(17)18)4-5-12-14(2)7-11(16)8-15(12,3)19-9-14/h4-6,12H,7-9H2,1-3H3,(H,17,18)/t12-,14-,15+/m1/s1 |
| InChIKey | YNCRBFODOPHHAO-YUELXQCFSA-N |
| XLogP | 2.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|