C15H24O4 — CID 163124069
5-[2-hydroxy-2-(hydroxymethyl)-6,6-dimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 163124069) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 5-[2-hydroxy-2-(hydroxymethyl)-6,6-dimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[2-hydroxy-2-(hydroxymethyl)-6,6-dimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 163124069 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-[2-hydroxy-2-(hydroxymethyl)-6,6-dimethylcyclohexyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=CC1C(C)(C)CCCC1(O)CO)=CC(=O)O |
| InChI | InChI=1S/C15H24O4/c1-11(9-13(17)18)5-6-12-14(2,3)7-4-8-15(12,19)10-16/h5-6,9,12,16,19H,4,7-8,10H2,1-3H3,(H,17,18) |
| InChIKey | CPCPGWKAUSNIIR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|