C18H30N2O3 — CID 66856625
4-[(E)-3-(2,2,6,6-tetramethylcyclohexyl)prop-2-enoyl]piperazine-1-carboxylic acid (PubChem CID 66856625) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[(E)-3-(2,2,6,6-tetramethylcyclohexyl)prop-2-enoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(E)-3-(2,2,6,6-tetramethylcyclohexyl)prop-2-enoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 66856625 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 4-[(E)-3-(2,2,6,6-tetramethylcyclohexyl)prop-2-enoyl]piperazine-1-carboxylic acid |
| SMILES | CC1(C)CCCC(C)(C)C1/C=C/C(=O)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C18H30N2O3/c1-17(2)8-5-9-18(3,4)14(17)6-7-15(21)19-10-12-20(13-11-19)16(22)23/h6-7,14H,5,8-13H2,1-4H3,(H,22,23)/b7-6+ |
| InChIKey | ZMGDFDDMMIRUBL-VOTSOKGWSA-N |
| XLogP | 3.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|