C17H26N2O4 — CID 66855941
4-[3-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylic acid (PubChem CID 66855941) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[3-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 66855941 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[3-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylic acid |
| SMILES | CC1=C(C=CC(=O)N2CCN(C(=O)O)CC2)C(C)(C)CCC1O |
| InChI | InChI=1S/C17H26N2O4/c1-12-13(17(2,3)7-6-14(12)20)4-5-15(21)18-8-10-19(11-9-18)16(22)23/h4-5,14,20H,6-11H2,1-3H3,(H,22,23) |
| InChIKey | IDWHAZSOUXGNDK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|