C17H26N2O3 — CID 75307497
[1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 75307497) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 75307497 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CC1=C(C=CC(=O)N2CCC(NC(=O)O)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-5-4-9-17(2,3)14(12)6-7-15(20)19-10-8-13(11-19)18-16(21)22/h6-7,13,18H,4-5,8-11H2,1-3H3,(H,21,22) |
| InChIKey | HEGRKUQHEJXEGE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|