C30H46N2O — CID 71529092
(2E,4E,6E,8E)-3,7-dimethyl-1-(4-piperidin-1-ylpiperidin-1-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 71529092) has the molecular formula C30H46N2O and a molecular weight of 450.71 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-1-(4-piperidin-1-ylpiperidin-1-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-1-(4-piperidin-1-ylpiperidin-1-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 71529092 |
| Molecular Formula | C30H46N2O |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-1-(4-piperidin-1-ylpiperidin-1-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N2CCC(N3CCCCC3)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H46N2O/c1-24(14-15-28-26(3)13-10-18-30(28,4)5)11-9-12-25(2)23-29(33)32-21-16-27(17-22-32)31-19-7-6-8-20-31/h9,11-12,14-15,23,27H,6-8,10,13,16-22H2,1-5H3/b12-9+,15-14+,24-11+,25-23+ |
| InChIKey | GVPZQRLPQCLULE-RTIXDFNESA-N |
| XLogP | 6.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|