C27H37NO — CID 161097023
(2E,4E,6Z,8E)-3,7-dimethyl-1-(7-methylidene-5-azaspiro[2.4]heptan-5-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 161097023) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-3,7-dimethyl-1-(7-methylidene-5-azaspiro[2.4]heptan-5-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6Z,8E)-3,7-dimethyl-1-(7-methylidene-5-azaspiro[2.4]heptan-5-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 161097023 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | (2E,4E,6Z,8E)-3,7-dimethyl-1-(7-methylidene-5-azaspiro[2.4]heptan-5-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | C=C1CN(C(=O)/C=C(C)/C=C/C=C(C)\C=C\C2=C(C)CCCC2(C)C)CC12CC2 |
| InChI | InChI=1S/C27H37NO/c1-20(12-13-24-22(3)11-8-14-26(24,5)6)9-7-10-21(2)17-25(29)28-18-23(4)27(19-28)15-16-27/h7,9-10,12-13,17H,4,8,11,14-16,18-19H2,1-3,5-6H3/b10-7+,13-12+,20-9-,21-17+ |
| InChIKey | GIUSRQONOGTORL-PTZNJZDMSA-N |
| XLogP | 6.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|