C19H32N2O — CID 66857276
(E)-1-(4-propylpiperazin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 66857276) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is (E)-1-(4-propylpiperazin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-propylpiperazin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66857276 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | (E)-1-(4-propylpiperazin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CCCN1CCN(C(=O)/C=C/C2=C(C)CCCC2(C)C)CC1 |
| InChI | InChI=1S/C19H32N2O/c1-5-11-20-12-14-21(15-13-20)18(22)9-8-17-16(2)7-6-10-19(17,3)4/h8-9H,5-7,10-15H2,1-4H3/b9-8+ |
| InChIKey | OXMXCYQCCHPPJM-CMDGGOBGSA-N |
| XLogP | 3.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|