C16H26N2O — CID 87180865
(E)-3-(3,3-dideuterio-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one (PubChem CID 87180865) has the molecular formula C16H26N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (E)-3-(3,3-dideuterio-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-(3,3-dideuterio-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 87180865 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (E)-3-(3,3-dideuterio-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one |
| SMILES | [2H]C1([2H])CCC(C)(C)C(/C=C/C(=O)N2CCNCC2)=C1C |
| InChI | InChI=1S/C16H26N2O/c1-13-5-4-8-16(2,3)14(13)6-7-15(19)18-11-9-17-10-12-18/h6-7,17H,4-5,8-12H2,1-3H3/b7-6+/i5D2 |
| InChIKey | HSCBDKIKJUAJJK-YUQBYFPGSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|