C19H31N2O3+ — CID 66856194
1-methyl-4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]-1,4-diazepan-1-ium-1-carboxylic acid (PubChem CID 66856194) has the molecular formula C19H31N2O3+ and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-methyl-4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]-1,4-diazepan-1-ium-1-carboxylic acid.
| Compound Name | 1-methyl-4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]-1,4-diazepan-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 66856194 |
| Molecular Formula | C19H31N2O3+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-methyl-4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]-1,4-diazepan-1-ium-1-carboxylic acid |
| SMILES | CC1=C(C=CC(=O)N2CCC[N+](C)(C(=O)O)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H30N2O3/c1-15-7-5-10-19(2,3)16(15)8-9-17(22)20-11-6-13-21(4,14-12-20)18(23)24/h8-9H,5-7,10-14H2,1-4H3/p+1 |
| InChIKey | VYOBDENNSAUNCH-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|