C17H26N2O3 — CID 66857335
[(3R)-1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl] carbamate (PubChem CID 66857335) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [(3R)-1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl] carbamate.
| Compound Name | [(3R)-1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 66857335 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [(3R)-1-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]pyrrolidin-3-yl] carbamate |
| SMILES | CC1=C(C=CC(=O)N2CC[C@@H](OC(N)=O)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-5-4-9-17(2,3)14(12)6-7-15(20)19-10-8-13(11-19)22-16(18)21/h6-7,13H,4-5,8-11H2,1-3H3,(H2,18,21)/t13-/m1/s1 |
| InChIKey | URZTWUQGCXDBPI-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|