C21H34N2O3 — CID 90710499
tert-butyl 4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 90710499) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90710499 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl 4-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CC1=C(C=CC(=O)N2CCN(C(=O)OC(C)(C)C)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H34N2O3/c1-16-8-7-11-21(5,6)17(16)9-10-18(24)22-12-14-23(15-13-22)19(25)26-20(2,3)4/h9-10H,7-8,11-15H2,1-6H3 |
| InChIKey | VSBPRMKBRYAERV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|