C16H27NO2S2 — CID 138677453
(E)-1-(1-sulfinyl-1,4-thiazinan-4-yl)-3-(2,2,6-trimethylcyclohexyl)prop-2-en-1-one (PubChem CID 138677453) has the molecular formula C16H27NO2S2 and a molecular weight of 329.53 g/mol. Its IUPAC name is (E)-1-(1-sulfinyl-1,4-thiazinan-4-yl)-3-(2,2,6-trimethylcyclohexyl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-sulfinyl-1,4-thiazinan-4-yl)-3-(2,2,6-trimethylcyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 138677453 |
| Molecular Formula | C16H27NO2S2 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (E)-1-(1-sulfinyl-1,4-thiazinan-4-yl)-3-(2,2,6-trimethylcyclohexyl)prop-2-en-1-one |
| SMILES | CC1CCCC(C)(C)C1/C=C/C(=O)N1CCS(=S=O)CC1 |
| InChI | InChI=1S/C16H27NO2S2/c1-13-5-4-8-16(2,3)14(13)6-7-15(18)17-9-11-21(20-19)12-10-17/h6-7,13-14H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | ICARFJQQJKQLDW-VOTSOKGWSA-N |
| XLogP | 2.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|