C23H30O2 — CID 173303568
[4-methyl-6-(2,2,6-trimethylcyclohexyl)hexa-1,3,5-trienyl] benzoate (PubChem CID 173303568) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is [4-methyl-6-(2,2,6-trimethylcyclohexyl)hexa-1,3,5-trienyl] benzoate.
| Compound Name | [4-methyl-6-(2,2,6-trimethylcyclohexyl)hexa-1,3,5-trienyl] benzoate |
|---|---|
| PubChem CID | 173303568 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [4-methyl-6-(2,2,6-trimethylcyclohexyl)hexa-1,3,5-trienyl] benzoate |
| SMILES | CC(C=CC1C(C)CCCC1(C)C)=CC=COC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30O2/c1-18(14-15-21-19(2)11-8-16-23(21,3)4)10-9-17-25-22(24)20-12-6-5-7-13-20/h5-7,9-10,12-15,17,19,21H,8,11,16H2,1-4H3 |
| InChIKey | CJXIKCPXARDXHB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|