(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid

C12H20O2 — CID 67805353

IUPAC(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid
SMILESCC1CCCC(C)(C)C1/C=C/C(=O)O
InChIInChI=1S/C12H20O2/c1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7,9-10H,4-5,8H2,1-3H3,(H,13,14)/b7-6+
InChIKeyNBWTZUVCCSKLLZ-VOTSOKGWSA-N
MW196.29 g/mol
LogP3.09
Rot. Bonds2

About (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid

(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid (PubChem CID 67805353) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid
PubChem CID67805353
Molecular FormulaC12H20O2
Molecular Weight196.29 g/mol
Exact Mass196.15
IUPAC Name(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid
SMILESCC1CCCC(C)(C)C1/C=C/C(=O)O
InChIInChI=1S/C12H20O2/c1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7,9-10H,4-5,8H2,1-3H3,(H,13,14)/b7-6+
InChIKeyNBWTZUVCCSKLLZ-VOTSOKGWSA-N
XLogP3.09
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.29
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid?
The IUPAC name of (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid (CID 67805353) is (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid is CC1CCCC(C)(C)C1/C=C/C(=O)O.
What is the InChIKey of (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid?
The InChIKey is NBWTZUVCCSKLLZ-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H20O2/c1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7,9-10H,4-5,8H2,1-3H3,(H,13,14)/b7-6+.
What are the key properties of (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid?
(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid has a molecular weight of 196.29 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid is sourced from PubChem (CID 67805353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).