C12H20O2 — CID 67805353
(E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid (PubChem CID 67805353) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67805353 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (E)-3-(2,2,6-trimethylcyclohexyl)prop-2-enoic acid |
| SMILES | CC1CCCC(C)(C)C1/C=C/C(=O)O |
| InChI | InChI=1S/C12H20O2/c1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7,9-10H,4-5,8H2,1-3H3,(H,13,14)/b7-6+ |
| InChIKey | NBWTZUVCCSKLLZ-VOTSOKGWSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|