C14H18O3 — CID 118146857
(2Z,4E)-5-[(1S,6R)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 118146857) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2Z,4E)-5-[(1S,6R)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1S,6R)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118146857 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2Z,4E)-5-[(1S,6R)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC1=CC(=O)C[C@@H](C)[C@H]1/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C14H18O3/c1-9(6-14(16)17)4-5-13-10(2)7-12(15)8-11(13)3/h4-7,11,13H,8H2,1-3H3,(H,16,17)/b5-4+,9-6-/t11-,13+/m1/s1 |
| InChIKey | NYPUQYYLGSKFIP-PXLKMAQASA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|