C24H36 — CID 54461340
1,3-ditert-butyl-5-[(1S)-1-methyl-2-[(3E)-3-methylpenta-1,3-dienyl]cyclopropyl]benzene (PubChem CID 54461340) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[(1S)-1-methyl-2-[(3E)-3-methylpenta-1,3-dienyl]cyclopropyl]benzene.
| Compound Name | 1,3-ditert-butyl-5-[(1S)-1-methyl-2-[(3E)-3-methylpenta-1,3-dienyl]cyclopropyl]benzene |
|---|---|
| PubChem CID | 54461340 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1,3-ditert-butyl-5-[(1S)-1-methyl-2-[(3E)-3-methylpenta-1,3-dienyl]cyclopropyl]benzene |
| SMILES | C/C=C(\C)C=CC1C[C@]1(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H36/c1-10-17(2)11-12-18-16-24(18,9)21-14-19(22(3,4)5)13-20(15-21)23(6,7)8/h10-15,18H,16H2,1-9H3/b12-11?,17-10+/t18?,24-/m0/s1 |
| InChIKey | XBVHIWKCWJMPQT-JSAGIMIOSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|