C29H41NO4 — CID 54333662
tert-butyl 6-[(1S)-2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1-methylcyclopropyl]-4,4,7-trimethyl-2,3-dihydroquinoline-1-carboxylate (PubChem CID 54333662) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is tert-butyl 6-[(1S)-2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1-methylcyclopropyl]-4,4,7-trimethyl-2,3-dihydroquinoline-1-carboxylate.
| Compound Name | tert-butyl 6-[(1S)-2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1-methylcyclopropyl]-4,4,7-trimethyl-2,3-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 54333662 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | tert-butyl 6-[(1S)-2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1-methylcyclopropyl]-4,4,7-trimethyl-2,3-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C1C[C@]1(C)c1cc2c(cc1C)N(C(=O)OC(C)(C)C)CCC2(C)C |
| InChI | InChI=1S/C29H41NO4/c1-10-33-25(31)15-19(2)11-12-21-18-29(21,9)22-17-23-24(16-20(22)3)30(14-13-28(23,7)8)26(32)34-27(4,5)6/h11-12,15-17,21H,10,13-14,18H2,1-9H3/b12-11+,19-15+/t21?,29-/m0/s1 |
| InChIKey | BROWYZGOXLHIGL-GIDANFCCSA-N |
| XLogP | 6.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|