C23H34O2 — CID 100953456
ethyl (2E,4E)-3-methyl-5-[(1S,2R)-2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclopropyl]penta-2,4-dienoate (PubChem CID 100953456) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is ethyl (2E,4E)-3-methyl-5-[(1S,2R)-2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclopropyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3-methyl-5-[(1S,2R)-2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclopropyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 100953456 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | ethyl (2E,4E)-3-methyl-5-[(1S,2R)-2-methyl-2-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclopropyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/[C@@H]1C[C@]1(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H34O2/c1-7-25-21(24)15-17(2)10-11-19-16-23(19,6)14-12-20-18(3)9-8-13-22(20,4)5/h10-12,14-15,19H,7-9,13,16H2,1-6H3/b11-10+,14-12+,17-15+/t19-,23+/m1/s1 |
| InChIKey | MNZYXNAVUPOJGH-PCAQGJMPSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|