C26H36O3 — CID 173224395
ethyl 5-[(1S,2S)-2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-2-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 173224395) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is ethyl 5-[(1S,2S)-2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-2-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[(1S,2S)-2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-2-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 173224395 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl 5-[(1S,2S)-2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-2-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=C[C@@H]1C[C@]1(C)C1Oc2c(C(C)(C)C)cccc2C1(C)C |
| InChI | InChI=1S/C26H36O3/c1-9-28-21(27)15-17(2)13-14-18-16-26(18,8)23-25(6,7)20-12-10-11-19(22(20)29-23)24(3,4)5/h10-15,18,23H,9,16H2,1-8H3/t18-,23?,26+/m1/s1 |
| InChIKey | HSYSOGLMIAZIAI-IAGVYGDFSA-N |
| XLogP | 6.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|