C20H24O3 — CID 54140589
ethyl 5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-carboxylate (PubChem CID 54140589) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 54140589 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | ethyl 5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C#CC=CC2=C(C)CCCC2(C)C)o1 |
| InChI | InChI=1S/C20H24O3/c1-5-22-19(21)18-13-12-16(23-18)10-6-7-11-17-15(2)9-8-14-20(17,3)4/h7,11-13H,5,8-9,14H2,1-4H3 |
| InChIKey | OAUXRUGCJAQINT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|