C19H30O2 — CID 58077901
2-[(E)-3-(2-methoxypropan-2-yloxy)-3-methylpent-1-en-4-ynyl]-1,3,3-trimethylcyclohexene (PubChem CID 58077901) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[(E)-3-(2-methoxypropan-2-yloxy)-3-methylpent-1-en-4-ynyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-3-(2-methoxypropan-2-yloxy)-3-methylpent-1-en-4-ynyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 58077901 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[(E)-3-(2-methoxypropan-2-yloxy)-3-methylpent-1-en-4-ynyl]-1,3,3-trimethylcyclohexene |
| SMILES | C#CC(C)(/C=C/C1=C(C)CCCC1(C)C)OC(C)(C)OC |
| InChI | InChI=1S/C19H30O2/c1-9-19(7,21-18(5,6)20-8)14-12-16-15(2)11-10-13-17(16,3)4/h1,12,14H,10-11,13H2,2-8H3/b14-12+ |
| InChIKey | LVMKCFGMBQZPAQ-WYMLVPIESA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|