C21H38OSi — CID 15440982
triethyl-[(1Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-yl]oxysilane (PubChem CID 15440982) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is triethyl-[(1Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-yl]oxysilane.
| Compound Name | triethyl-[(1Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 15440982 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | triethyl-[(1Z)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-yl]oxysilane |
| SMILES | C=CC(C)(/C=C\C1=C(C)CCCC1(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38OSi/c1-9-21(8,22-23(10-2,11-3)12-4)17-15-19-18(5)14-13-16-20(19,6)7/h9,15,17H,1,10-14,16H2,2-8H3/b17-15- |
| InChIKey | UYQUHMZMBXZKEA-ICFOKQHNSA-N |
| XLogP | 7.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|