C16H28Si — CID 11470674
trimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]silane (PubChem CID 11470674) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is trimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]silane.
| Compound Name | trimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 11470674 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | trimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]silane |
| SMILES | CC1=C(/C=C/C=C/[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H28Si/c1-14-10-9-12-16(2,3)15(14)11-7-8-13-17(4,5)6/h7-8,11,13H,9-10,12H2,1-6H3/b11-7+,13-8+ |
| InChIKey | VGHZBQIVALEFTM-ZHSLHGDYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|