C10H16O — CID 11228964
2,6,6-tri((113C)methyl)(1,2,3,4,5,6-13C6)cyclohexene-1-carbaldehyde (PubChem CID 11228964) has the molecular formula C10H16O and a molecular weight of 162.16 g/mol. Its IUPAC name is 2,6,6-tri((113C)methyl)(1,2,3,4,5,6-13C6)cyclohexene-1-carbaldehyde.
| Compound Name | 2,6,6-tri((113C)methyl)(1,2,3,4,5,6-13C6)cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 11228964 |
| Molecular Formula | C10H16O |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.15 |
| IUPAC Name | 2,6,6-tri((113C)methyl)(1,2,3,4,5,6-13C6)cyclohexene-1-carbaldehyde |
| SMILES | [13CH3][13C]1=[13C]([13CH]=O)[13C]([13CH3])([13CH3])[13CH2][13CH2][13CH2]1 |
| InChI | InChI=1S/C10H16O/c1-8-5-4-6-10(2,3)9(8)7-11/h7H,4-6H2,1-3H3/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
| InChIKey | MOQGCGNUWBPGTQ-IIYFYTTLSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|