C12H18O — CID 121014603
2,6-dimethyl-6-prop-2-enylcyclohexene-1-carbaldehyde (PubChem CID 121014603) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,6-dimethyl-6-prop-2-enylcyclohexene-1-carbaldehyde.
| Compound Name | 2,6-dimethyl-6-prop-2-enylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 121014603 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2,6-dimethyl-6-prop-2-enylcyclohexene-1-carbaldehyde |
| SMILES | C=CCC1(C)CCCC(C)=C1C=O |
| InChI | InChI=1S/C12H18O/c1-4-7-12(3)8-5-6-10(2)11(12)9-13/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | IZLMCOREMQOTIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|