C18H24O — CID 15517576
(2E,4E,6E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal (PubChem CID 15517576) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 15517576 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (2E,4E,6E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC1=C(/C=C/C=C/C=C/C=C/C=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H24O/c1-16-12-11-14-18(2,3)17(16)13-9-7-5-4-6-8-10-15-19/h4-10,13,15H,11-12,14H2,1-3H3/b6-4+,7-5+,10-8+,13-9+ |
| InChIKey | LQUMYDAOKHBIJN-IGEUGCNCSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|