C14H19ClO — CID 10776362
(2Z,4E)-3-chloro-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal (PubChem CID 10776362) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (2Z,4E)-3-chloro-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal.
| Compound Name | (2Z,4E)-3-chloro-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 10776362 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2Z,4E)-3-chloro-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienal |
| SMILES | CC1=C(/C=C/C(Cl)=C/C=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H19ClO/c1-11-5-4-9-14(2,3)13(11)7-6-12(15)8-10-16/h6-8,10H,4-5,9H2,1-3H3/b7-6+,12-8- |
| InChIKey | OFYTYBIWBDUSLF-KWUPLBGHSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|