C17H28O2 — CID 15463222
2-[(E)-5,5-dimethoxy-3-methylidenepent-1-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 15463222) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-[(E)-5,5-dimethoxy-3-methylidenepent-1-enyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-5,5-dimethoxy-3-methylidenepent-1-enyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 15463222 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-[(E)-5,5-dimethoxy-3-methylidenepent-1-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | C=C(/C=C/C1=C(C)CCCC1(C)C)CC(OC)OC |
| InChI | InChI=1S/C17H28O2/c1-13(12-16(18-5)19-6)9-10-15-14(2)8-7-11-17(15,3)4/h9-10,16H,1,7-8,11-12H2,2-6H3/b10-9+ |
| InChIKey | VLDZSVKURUPQJX-MDZDMXLPSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|