C20H28O — CID 11601646
(2E,4E,8E)-2-methyl-7-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienal (PubChem CID 11601646) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (2E,4E,8E)-2-methyl-7-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienal.
| Compound Name | (2E,4E,8E)-2-methyl-7-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienal |
|---|---|
| PubChem CID | 11601646 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2E,4E,8E)-2-methyl-7-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienal |
| SMILES | C=C(/C=C/C1=C(C)CCCC1(C)C)C/C=C/C=C(\C)C=O |
| InChI | InChI=1S/C20H28O/c1-16(9-6-7-10-17(2)15-21)12-13-19-18(3)11-8-14-20(19,4)5/h6-7,10,12-13,15H,1,8-9,11,14H2,2-5H3/b7-6+,13-12+,17-10+ |
| InChIKey | QXGCWDXKLITRMW-FQZUGACUSA-N |
| XLogP | 5.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|