C26H38 — CID 145154036
2-[(1E,3E,5E,7E)-3,7-dimethyl-9-methylidenedodeca-1,3,5,7-tetraen-11-ynyl]-1,3,3-trimethylcyclohexene;ethane (PubChem CID 145154036) has the molecular formula C26H38 and a molecular weight of 350.59 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-3,7-dimethyl-9-methylidenedodeca-1,3,5,7-tetraen-11-ynyl]-1,3,3-trimethylcyclohexene;ethane.
| Compound Name | 2-[(1E,3E,5E,7E)-3,7-dimethyl-9-methylidenedodeca-1,3,5,7-tetraen-11-ynyl]-1,3,3-trimethylcyclohexene;ethane |
|---|---|
| PubChem CID | 145154036 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-3,7-dimethyl-9-methylidenedodeca-1,3,5,7-tetraen-11-ynyl]-1,3,3-trimethylcyclohexene;ethane |
| SMILES | C#CCC(=C)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C.CC |
| InChI | InChI=1S/C24H32.C2H6/c1-8-11-20(3)18-21(4)13-9-12-19(2)15-16-23-22(5)14-10-17-24(23,6)7;1-2/h1,9,12-13,15-16,18H,3,10-11,14,17H2,2,4-7H3;1-2H3/b13-9+,16-15+,19-12+,21-18+; |
| InChIKey | SXZGZZRCFBDTBY-XLKDMYCWSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|