C21H31N3S — CID 16724970
[(Z)-[(2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]thiourea (PubChem CID 16724970) has the molecular formula C21H31N3S and a molecular weight of 357.57 g/mol. Its IUPAC name is [(Z)-[(2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]thiourea.
| Compound Name | [(Z)-[(2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]thiourea |
|---|---|
| PubChem CID | 16724970 |
| Molecular Formula | C21H31N3S |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [(Z)-[(2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]thiourea |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C=N/NC(N)=S)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31N3S/c1-16(8-6-9-17(2)13-15-23-24-20(22)25)11-12-19-18(3)10-7-14-21(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3,(H3,22,24,25)/b9-6+,12-11+,16-8-,17-13+,23-15- |
| InChIKey | JQKGIPVMXHVEOF-QBCRHDKISA-N |
| XLogP | 5.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|