C27H37NO — CID 21275511
N-butyl-4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzamide (PubChem CID 21275511) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is N-butyl-4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzamide.
| Compound Name | N-butyl-4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzamide |
|---|---|
| PubChem CID | 21275511 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | N-butyl-4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C27H37NO/c1-6-7-20-28-26(29)24-16-14-23(15-17-24)12-8-10-21(2)13-18-25-22(3)11-9-19-27(25,4)5/h8,10,12-18H,6-7,9,11,19-20H2,1-5H3,(H,28,29)/b12-8+,18-13+,21-10+ |
| InChIKey | PMQVXKDSSVJXHS-XQVBYQDUSA-N |
| XLogP | 7.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|