C27H35NOS — CID 54048073
N-butyl-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide (PubChem CID 54048073) has the molecular formula C27H35NOS and a molecular weight of 421.65 g/mol. Its IUPAC name is N-butyl-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide.
| Compound Name | N-butyl-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 54048073 |
| Molecular Formula | C27H35NOS |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-butyl-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2cc(C=C(C)C=CC3=C(C)CCCC3(C)C)sc2c1 |
| InChI | InChI=1S/C27H35NOS/c1-6-7-15-28-26(29)22-12-11-21-17-23(30-25(21)18-22)16-19(2)10-13-24-20(3)9-8-14-27(24,4)5/h10-13,16-18H,6-9,14-15H2,1-5H3,(H,28,29) |
| InChIKey | LQYDTOVAMHLMQU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|