C24H34N2O2 — CID 54188370
pentyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate (PubChem CID 54188370) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is pentyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate.
| Compound Name | pentyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 54188370 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | pentyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate |
| SMILES | CCCCCOC(=O)c1ncc(C=C(C)C=CC2=C(C)CCCC2(C)C)cn1 |
| InChI | InChI=1S/C24H34N2O2/c1-6-7-8-14-28-23(27)22-25-16-20(17-26-22)15-18(2)11-12-21-19(3)10-9-13-24(21,4)5/h11-12,15-17H,6-10,13-14H2,1-5H3 |
| InChIKey | PGSUJINAVKRLJT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|